C21H26O5S — CID 8836687
[2-(1-adamantyl)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate (PubChem CID 8836687) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 8836687 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)OCC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H26O5S/c1-27(24,25)13-14-3-2-4-18(8-14)20(23)26-12-19(22)21-9-15-5-16(10-21)7-17(6-15)11-21/h2-4,8,15-17H,5-7,9-13H2,1H3 |
| InChIKey | HZRPWPUDGHMNJK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |