C19H14FNO5 — CID 7204779
[2-(2-fluorophenyl)-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204779) has the molecular formula C19H14FNO5 and a molecular weight of 355.32 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204779 |
| Molecular Formula | C19H14FNO5 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCC(=O)c1ccccc1F)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C19H14FNO5/c20-15-7-2-1-6-14(15)16(22)11-26-19(25)12-4-3-5-13(10-12)21-17(23)8-9-18(21)24/h1-7,10H,8-9,11H2 |
| InChIKey | ZGRUTIPIBXQXQH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|