C19H15FN2O5 — CID 7204444
[2-(3-fluoroanilino)-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204444) has the molecular formula C19H15FN2O5 and a molecular weight of 370.34 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204444 |
| Molecular Formula | C19H15FN2O5 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)CCC2=O)c1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H15FN2O5/c20-13-4-2-5-14(10-13)21-16(23)11-27-19(26)12-3-1-6-15(9-12)22-17(24)7-8-18(22)25/h1-6,9-10H,7-8,11H2,(H,21,23) |
| InChIKey | XJZBEUNKJLOCAH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|