C15H13F3N2O5 — CID 7204495
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204495) has the molecular formula C15H13F3N2O5 and a molecular weight of 358.27 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204495 |
| Molecular Formula | C15H13F3N2O5 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)CCC2=O)c1)NCC(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O5/c16-15(17,18)8-19-11(21)7-25-14(24)9-2-1-3-10(6-9)20-12(22)4-5-13(20)23/h1-3,6H,4-5,7-8H2,(H,19,21) |
| InChIKey | SHSXIAUUSOOSSE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|