C23H24N2O7 — CID 34651691
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 34651691) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 34651691 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CCOc1ccc(OCCNC(=O)COC(=O)c2cccc(N3C(=O)CCC3=O)c2)cc1 |
| InChI | InChI=1S/C23H24N2O7/c1-2-30-18-6-8-19(9-7-18)31-13-12-24-20(26)15-32-23(29)16-4-3-5-17(14-16)25-21(27)10-11-22(25)28/h3-9,14H,2,10-13,15H2,1H3,(H,24,26) |
| InChIKey | BHXYEYNQSVYEDT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|