C12H13N3O4 — CID 165482135
5-(3-oxomorpholin-4-yl)benzene-1,3-dicarboxamide (PubChem CID 165482135) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 5-(3-oxomorpholin-4-yl)benzene-1,3-dicarboxamide.
| Compound Name | 5-(3-oxomorpholin-4-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 165482135 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-(3-oxomorpholin-4-yl)benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(C(N)=O)cc(N2CCOCC2=O)c1 |
| InChI | InChI=1S/C12H13N3O4/c13-11(17)7-3-8(12(14)18)5-9(4-7)15-1-2-19-6-10(15)16/h3-5H,1-2,6H2,(H2,13,17)(H2,14,18) |
| InChIKey | XCJULKFWUJLNLS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |