C11H13N3O4 — CID 91756600
methyl 2-amino-5-(3-oxomorpholin-4-yl)pyridine-3-carboxylate (PubChem CID 91756600) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 2-amino-5-(3-oxomorpholin-4-yl)pyridine-3-carboxylate.
| Compound Name | methyl 2-amino-5-(3-oxomorpholin-4-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 91756600 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | methyl 2-amino-5-(3-oxomorpholin-4-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(N2CCOCC2=O)cnc1N |
| InChI | InChI=1S/C11H13N3O4/c1-17-11(16)8-4-7(5-13-10(8)12)14-2-3-18-6-9(14)15/h4-5H,2-3,6H2,1H3,(H2,12,13) |
| InChIKey | CRLZXBOEJBZTBY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |