C13H17NO5 — CID 165481703
4-(3,4,5-trimethoxyphenyl)morpholin-3-one (PubChem CID 165481703) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenyl)morpholin-3-one.
| Compound Name | 4-(3,4,5-trimethoxyphenyl)morpholin-3-one |
|---|---|
| PubChem CID | 165481703 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenyl)morpholin-3-one |
| SMILES | COc1cc(N2CCOCC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C13H17NO5/c1-16-10-6-9(7-11(17-2)13(10)18-3)14-4-5-19-8-12(14)15/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | COYOGIUROVZDGQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |