C12H14BrNO2 — CID 66816624
4-(4-bromo-3,5-dimethylphenyl)morpholin-3-one (PubChem CID 66816624) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 4-(4-bromo-3,5-dimethylphenyl)morpholin-3-one.
| Compound Name | 4-(4-bromo-3,5-dimethylphenyl)morpholin-3-one |
|---|---|
| PubChem CID | 66816624 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 4-(4-bromo-3,5-dimethylphenyl)morpholin-3-one |
| SMILES | Cc1cc(N2CCOCC2=O)cc(C)c1Br |
| InChI | InChI=1S/C12H14BrNO2/c1-8-5-10(6-9(2)12(8)13)14-3-4-16-7-11(14)15/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | NAUOXGBBFPNDIU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |