C23H18N2O3 — CID 142743521
4-phenyl-11-(2-phenylethenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 142743521) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-phenyl-11-(2-phenylethenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | 4-phenyl-11-(2-phenylethenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 142743521 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-phenyl-11-(2-phenylethenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | O=C1C=CC2C3C(=O)N(c4ccccc4)C(=O)C3C1N2C=Cc1ccccc1 |
| InChI | InChI=1S/C23H18N2O3/c26-18-12-11-17-19-20(21(18)24(17)14-13-15-7-3-1-4-8-15)23(28)25(22(19)27)16-9-5-2-6-10-16/h1-14,17,19-21H |
| InChIKey | MNZNTCBLMWUKKV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|