C24H16N4O8 — CID 142743508
11-[(E)-3-(2,4-dinitrophenyl)-3-oxoprop-1-enyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 142743508) has the molecular formula C24H16N4O8 and a molecular weight of 488.41 g/mol. Its IUPAC name is 11-[(E)-3-(2,4-dinitrophenyl)-3-oxoprop-1-enyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | 11-[(E)-3-(2,4-dinitrophenyl)-3-oxoprop-1-enyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 142743508 |
| Molecular Formula | C24H16N4O8 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 11-[(E)-3-(2,4-dinitrophenyl)-3-oxoprop-1-enyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | O=C(/C=C/N1C2C=CC(=O)C1C1C(=O)N(c3ccccc3)C(=O)C12)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16N4O8/c29-18(15-7-6-14(27(33)34)12-17(15)28(35)36)10-11-25-16-8-9-19(30)22(25)21-20(16)23(31)26(24(21)32)13-4-2-1-3-5-13/h1-12,16,20-22H/b11-10+ |
| InChIKey | VTUFFMRYAQGVRZ-ZHACJKMWSA-N |
| XLogP | 2.20 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|