C34H23N3O7 — CID 98455783
(4-benzoylphenyl) (10R,11S,15S,16S)-13-(3-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 98455783) has the molecular formula C34H23N3O7 and a molecular weight of 585.57 g/mol. Its IUPAC name is (4-benzoylphenyl) (10R,11S,15S,16S)-13-(3-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | (4-benzoylphenyl) (10R,11S,15S,16S)-13-(3-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 98455783 |
| Molecular Formula | C34H23N3O7 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | (4-benzoylphenyl) (10R,11S,15S,16S)-13-(3-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | O=C(c1ccccc1)c1ccc(OC(=O)[C@@H]2[C@H]3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)[C@@H]3[C@H]3C=Cc4ccccc4N32)cc1 |
| InChI | InChI=1S/C34H23N3O7/c38-31(21-8-2-1-3-9-21)22-13-16-25(17-14-22)44-34(41)30-29-28(27-18-15-20-7-4-5-12-26(20)36(27)30)32(39)35(33(29)40)23-10-6-11-24(19-23)37(42)43/h1-19,27-30H/t27-,28-,29+,30+/m1/s1 |
| InChIKey | PDTKWHWUXPKTSO-XAZDILKDSA-N |
| XLogP | 4.82 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|