C36H26N2O7 — CID 98456641
(4-benzoylphenyl) (10R,11S,15S,16S)-13-(2,3-dihydro-1,4-benzodioxin-6-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 98456641) has the molecular formula C36H26N2O7 and a molecular weight of 598.61 g/mol. Its IUPAC name is (4-benzoylphenyl) (10R,11S,15S,16S)-13-(2,3-dihydro-1,4-benzodioxin-6-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | (4-benzoylphenyl) (10R,11S,15S,16S)-13-(2,3-dihydro-1,4-benzodioxin-6-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 98456641 |
| Molecular Formula | C36H26N2O7 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | (4-benzoylphenyl) (10R,11S,15S,16S)-13-(2,3-dihydro-1,4-benzodioxin-6-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | O=C(c1ccccc1)c1ccc(OC(=O)[C@@H]2[C@H]3C(=O)N(c4ccc5c(c4)OCCO5)C(=O)[C@@H]3[C@H]3C=Cc4ccccc4N32)cc1 |
| InChI | InChI=1S/C36H26N2O7/c39-33(22-7-2-1-3-8-22)23-10-14-25(15-11-23)45-36(42)32-31-30(27-16-12-21-6-4-5-9-26(21)38(27)32)34(40)37(35(31)41)24-13-17-28-29(20-24)44-19-18-43-28/h1-17,20,27,30-32H,18-19H2/t27-,30-,31+,32+/m1/s1 |
| InChIKey | IABRKLNXXIXPKZ-WBRFVXMESA-N |
| XLogP | 4.68 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|