C34H23ClN2O5 — CID 100877220
(4-benzoylphenyl) (10R,11R,15R,16S)-13-(4-chlorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 100877220) has the molecular formula C34H23ClN2O5 and a molecular weight of 575.02 g/mol. Its IUPAC name is (4-benzoylphenyl) (10R,11R,15R,16S)-13-(4-chlorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | (4-benzoylphenyl) (10R,11R,15R,16S)-13-(4-chlorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 100877220 |
| Molecular Formula | C34H23ClN2O5 |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | (4-benzoylphenyl) (10R,11R,15R,16S)-13-(4-chlorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | O=C(c1ccccc1)c1ccc(OC(=O)[C@@H]2[C@@H]3C(=O)N(c4ccc(Cl)cc4)C(=O)[C@H]3[C@H]3C=Cc4ccccc4N32)cc1 |
| InChI | InChI=1S/C34H23ClN2O5/c35-23-13-15-24(16-14-23)36-32(39)28-27-19-12-20-6-4-5-9-26(20)37(27)30(29(28)33(36)40)34(41)42-25-17-10-22(11-18-25)31(38)21-7-2-1-3-8-21/h1-19,27-30H/t27-,28+,29-,30+/m1/s1 |
| InChIKey | BICJWSKUYPHEBK-ATIZSFMBSA-N |
| XLogP | 5.57 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|