C27H19ClN2O3 — CID 3774989
16-benzoyl-13-(4-chlorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 3774989) has the molecular formula C27H19ClN2O3 and a molecular weight of 454.91 g/mol. Its IUPAC name is 16-benzoyl-13-(4-chlorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | 16-benzoyl-13-(4-chlorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 3774989 |
| Molecular Formula | C27H19ClN2O3 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 16-benzoyl-13-(4-chlorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | O=C(c1ccccc1)C1C2C(=O)N(c3ccc(Cl)cc3)C(=O)C2C2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C27H19ClN2O3/c28-18-11-13-19(14-12-18)29-26(32)22-21-15-10-16-6-4-5-9-20(16)30(21)24(23(22)27(29)33)25(31)17-7-2-1-3-8-17/h1-15,21-24H |
| InChIKey | HUWVFIQPYKZGMZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|