C28H22N2O3 — CID 40907344
(10S,11R,15R,16S)-16-benzoyl-13-(4-methylphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 40907344) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is (10S,11R,15R,16S)-16-benzoyl-13-(4-methylphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10S,11R,15R,16S)-16-benzoyl-13-(4-methylphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 40907344 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (10S,11R,15R,16S)-16-benzoyl-13-(4-methylphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H]2C=Cc4ccccc4N2[C@@H]3C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N2O3/c1-17-11-14-20(15-12-17)29-27(32)23-22-16-13-18-7-5-6-10-21(18)30(22)25(24(23)28(29)33)26(31)19-8-3-2-4-9-19/h2-16,22-25H,1H3/t22-,23-,24+,25-/m0/s1 |
| InChIKey | DOEDEFKGCVGNNU-JBXUNAHCSA-N |
| XLogP | 4.27 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|