C32H24N2O3 — CID 6582706
(3S,4R,8R,9R)-3-benzoyl-6-(4-methylphenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione (PubChem CID 6582706) has the molecular formula C32H24N2O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is (3S,4R,8R,9R)-3-benzoyl-6-(4-methylphenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione.
| Compound Name | (3S,4R,8R,9R)-3-benzoyl-6-(4-methylphenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione |
|---|---|
| PubChem CID | 6582706 |
| Molecular Formula | C32H24N2O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (3S,4R,8R,9R)-3-benzoyl-6-(4-methylphenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H](C(=O)c2ccccc2)N2c4ccc5ccccc5c4C=C[C@H]32)cc1 |
| InChI | InChI=1S/C32H24N2O3/c1-19-11-14-22(15-12-19)33-31(36)27-26-18-16-24-23-10-6-5-7-20(23)13-17-25(24)34(26)29(28(27)32(33)37)30(35)21-8-3-2-4-9-21/h2-18,26-29H,1H3/t26-,27+,28-,29+/m1/s1 |
| InChIKey | XRMGIPUNQCJPDW-AIQXTLEGSA-N |
| XLogP | 5.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|