C31H21ClN2O3 — CID 3512784
3-benzoyl-6-(4-chlorophenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione (PubChem CID 3512784) has the molecular formula C31H21ClN2O3 and a molecular weight of 504.97 g/mol. Its IUPAC name is 3-benzoyl-6-(4-chlorophenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione.
| Compound Name | 3-benzoyl-6-(4-chlorophenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione |
|---|---|
| PubChem CID | 3512784 |
| Molecular Formula | C31H21ClN2O3 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 3-benzoyl-6-(4-chlorophenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione |
| SMILES | O=C(c1ccccc1)C1C2C(=O)N(c3ccc(Cl)cc3)C(=O)C2C2C=Cc3c(ccc4ccccc34)N21 |
| InChI | InChI=1S/C31H21ClN2O3/c32-20-11-13-21(14-12-20)33-30(36)26-25-17-15-23-22-9-5-4-6-18(22)10-16-24(23)34(25)28(27(26)31(33)37)29(35)19-7-2-1-3-8-19/h1-17,25-28H |
| InChIKey | FMZOGQKQJMWMSG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|