C33H26N2O3 — CID 124796521
(3S,4S,8R,9S)-3-benzoyl-6-(2,4-dimethylphenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione (PubChem CID 124796521) has the molecular formula C33H26N2O3 and a molecular weight of 498.58 g/mol. Its IUPAC name is (3S,4S,8R,9S)-3-benzoyl-6-(2,4-dimethylphenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione.
| Compound Name | (3S,4S,8R,9S)-3-benzoyl-6-(2,4-dimethylphenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione |
|---|---|
| PubChem CID | 124796521 |
| Molecular Formula | C33H26N2O3 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (3S,4S,8R,9S)-3-benzoyl-6-(2,4-dimethylphenyl)-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-5,7-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H](C(=O)c2ccccc2)N2c4ccc5ccccc5c4C=C[C@@H]32)c(C)c1 |
| InChI | InChI=1S/C33H26N2O3/c1-19-12-15-25(20(2)18-19)35-32(37)28-27-17-14-24-23-11-7-6-8-21(23)13-16-26(24)34(27)30(29(28)33(35)38)31(36)22-9-4-3-5-10-22/h3-18,27-30H,1-2H3/t27-,28-,29-,30-/m0/s1 |
| InChIKey | UYDRRVYKOISVMA-KRCBVYEFSA-N |
| XLogP | 5.73 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|