C29H24N2O6 — CID 3695141
ethyl 6-(2-methoxycarbonylphenyl)-5,7-dioxo-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-3-carboxylate (PubChem CID 3695141) has the molecular formula C29H24N2O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is ethyl 6-(2-methoxycarbonylphenyl)-5,7-dioxo-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-3-carboxylate.
| Compound Name | ethyl 6-(2-methoxycarbonylphenyl)-5,7-dioxo-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-3-carboxylate |
|---|---|
| PubChem CID | 3695141 |
| Molecular Formula | C29H24N2O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | ethyl 6-(2-methoxycarbonylphenyl)-5,7-dioxo-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-3-carboxylate |
| SMILES | CCOC(=O)C1C2C(=O)N(c3ccccc3C(=O)OC)C(=O)C2C2C=Cc3c(ccc4ccccc34)N21 |
| InChI | InChI=1S/C29H24N2O6/c1-3-37-29(35)25-24-23(26(32)31(27(24)33)20-11-7-6-10-19(20)28(34)36-2)22-15-13-18-17-9-5-4-8-16(17)12-14-21(18)30(22)25/h4-15,22-25H,3H2,1-2H3 |
| InChIKey | JPLHPGGNKVOZSF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|