C32H27NO4 — CID 98418648
methyl 2-[(1R,2S,6S,7R)-10-[bis(4-methylphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 98418648) has the molecular formula C32H27NO4 and a molecular weight of 489.57 g/mol. Its IUPAC name is methyl 2-[(1R,2S,6S,7R)-10-[bis(4-methylphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | methyl 2-[(1R,2S,6S,7R)-10-[bis(4-methylphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 98418648 |
| Molecular Formula | C32H27NO4 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | methyl 2-[(1R,2S,6S,7R)-10-[bis(4-methylphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2C1=C(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H27NO4/c1-18-8-12-20(13-9-18)26(21-14-10-19(2)11-15-21)27-23-16-17-24(27)29-28(23)30(34)33(31(29)35)25-7-5-4-6-22(25)32(36)37-3/h4-17,23-24,28-29H,1-3H3/t23-,24-,28-,29-/m0/s1 |
| InChIKey | MBUZLQHZBJEZQJ-HWJGEBQJSA-N |
| XLogP | 5.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|