C31H25NO4 — CID 26962217
ethyl 2-[(1S,2S,6R,7R)-10-benzhydrylidene-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 26962217) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,6R,7R)-10-benzhydrylidene-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | ethyl 2-[(1S,2S,6R,7R)-10-benzhydrylidene-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 26962217 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | ethyl 2-[(1S,2S,6R,7R)-10-benzhydrylidene-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2C1=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H25NO4/c1-2-36-31(35)21-15-9-10-16-24(21)32-29(33)27-22-17-18-23(28(27)30(32)34)26(22)25(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-18,22-23,27-28H,2H2,1H3/t22-,23+,27+,28- |
| InChIKey | QQJAOWZHNWOEHA-WJSCRPBKSA-N |
| XLogP | 5.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|