C27H20ClN3O6 — CID 40838698
ethyl (3R,4S,8S,9R)-6-(2-chloro-5-nitrophenyl)-5,7-dioxo-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-3-carboxylate (PubChem CID 40838698) has the molecular formula C27H20ClN3O6 and a molecular weight of 517.93 g/mol. Its IUPAC name is ethyl (3R,4S,8S,9R)-6-(2-chloro-5-nitrophenyl)-5,7-dioxo-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-3-carboxylate.
| Compound Name | ethyl (3R,4S,8S,9R)-6-(2-chloro-5-nitrophenyl)-5,7-dioxo-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-3-carboxylate |
|---|---|
| PubChem CID | 40838698 |
| Molecular Formula | C27H20ClN3O6 |
| Molecular Weight | 517.93 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | ethyl (3R,4S,8S,9R)-6-(2-chloro-5-nitrophenyl)-5,7-dioxo-2,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-1(12),10,13,15,17,19-hexaene-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N(c3cc([N+](=O)[O-])ccc3Cl)C(=O)[C@@H]2[C@H]2C=Cc3c(ccc4ccccc34)N21 |
| InChI | InChI=1S/C27H20ClN3O6/c1-2-37-27(34)24-23-22(25(32)30(26(23)33)21-13-15(31(35)36)8-10-18(21)28)20-12-9-17-16-6-4-3-5-14(16)7-11-19(17)29(20)24/h3-13,20,22-24H,2H2,1H3/t20-,22-,23+,24-/m1/s1 |
| InChIKey | BGGHYNLSYCAQES-CAUSLRQDSA-N |
| XLogP | 4.35 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|