C35H27N3O6 — CID 124837860
benzhydryl (10S,11R,15S,16R)-13-(2-methyl-4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 124837860) has the molecular formula C35H27N3O6 and a molecular weight of 585.62 g/mol. Its IUPAC name is benzhydryl (10S,11R,15S,16R)-13-(2-methyl-4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | benzhydryl (10S,11R,15S,16R)-13-(2-methyl-4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 124837860 |
| Molecular Formula | C35H27N3O6 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | benzhydryl (10S,11R,15S,16R)-13-(2-methyl-4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H](C(=O)OC(c1ccccc1)c1ccccc1)N1c3ccccc3C=C[C@@H]21 |
| InChI | InChI=1S/C35H27N3O6/c1-21-20-25(38(42)43)17-19-26(21)37-33(39)29-28-18-16-22-10-8-9-15-27(22)36(28)31(30(29)34(37)40)35(41)44-32(23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2-20,28-32H,1H3/t28-,29-,30-,31+/m0/s1 |
| InChIKey | OUSQTBGMORHWRY-XHPANXIASA-N |
| XLogP | 5.63 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|