C34H25N3O6 — CID 5027442
benzhydryl 13-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 5027442) has the molecular formula C34H25N3O6 and a molecular weight of 571.59 g/mol. Its IUPAC name is benzhydryl 13-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | benzhydryl 13-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 5027442 |
| Molecular Formula | C34H25N3O6 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | benzhydryl 13-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C1C2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C2C2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C34H25N3O6/c38-32-28-27-20-15-21-9-7-8-14-26(21)36(27)30(29(28)33(39)35(32)24-16-18-25(19-17-24)37(41)42)34(40)43-31(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-20,27-31H |
| InChIKey | RMVMWKIXQRQJKV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|