C36H28N2O5 — CID 124894682
benzhydryl (10R,11R,15S,16R)-13-(4-acetylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 124894682) has the molecular formula C36H28N2O5 and a molecular weight of 568.63 g/mol. Its IUPAC name is benzhydryl (10R,11R,15S,16R)-13-(4-acetylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | benzhydryl (10R,11R,15S,16R)-13-(4-acetylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 124894682 |
| Molecular Formula | C36H28N2O5 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | benzhydryl (10R,11R,15S,16R)-13-(4-acetylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H](C(=O)OC(c2ccccc2)c2ccccc2)N2c4ccccc4C=C[C@H]32)cc1 |
| InChI | InChI=1S/C36H28N2O5/c1-22(39)23-16-19-27(20-17-23)37-34(40)30-29-21-18-24-10-8-9-15-28(24)38(29)32(31(30)35(37)41)36(42)43-33(25-11-4-2-5-12-25)26-13-6-3-7-14-26/h2-21,29-33H,1H3/t29-,30+,31+,32-/m1/s1 |
| InChIKey | QAIQSRWHUWUWMC-OKDNLZPVSA-N |
| XLogP | 5.61 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|