C35H26N2O6 — CID 4977216
benzhydryl 13-(1,3-benzodioxol-5-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 4977216) has the molecular formula C35H26N2O6 and a molecular weight of 570.60 g/mol. Its IUPAC name is benzhydryl 13-(1,3-benzodioxol-5-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | benzhydryl 13-(1,3-benzodioxol-5-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 4977216 |
| Molecular Formula | C35H26N2O6 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | benzhydryl 13-(1,3-benzodioxol-5-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C1C2C(=O)N(c3ccc4c(c3)OCO4)C(=O)C2C2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C35H26N2O6/c38-33-29-26-17-15-21-9-7-8-14-25(21)37(26)31(30(29)34(39)36(33)24-16-18-27-28(19-24)42-20-41-27)35(40)43-32(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-19,26,29-32H,20H2 |
| InChIKey | CJYAQZWDHBWZDO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|