C34H25FN2O4 — CID 3851772
benzhydryl 13-(4-fluorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 3851772) has the molecular formula C34H25FN2O4 and a molecular weight of 544.58 g/mol. Its IUPAC name is benzhydryl 13-(4-fluorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | benzhydryl 13-(4-fluorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 3851772 |
| Molecular Formula | C34H25FN2O4 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | benzhydryl 13-(4-fluorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C1C2C(=O)N(c3ccc(F)cc3)C(=O)C2C2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C34H25FN2O4/c35-24-16-18-25(19-17-24)36-32(38)28-27-20-15-21-9-7-8-14-26(21)37(27)30(29(28)33(36)39)34(40)41-31(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-20,27-31H |
| InChIKey | ZWEFHBMDEHGSJH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|