C27H19ClFN3O3 — CID 6584849
(10R,11S,15R,16S)-N-(4-chlorophenyl)-13-(4-fluorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 6584849) has the molecular formula C27H19ClFN3O3 and a molecular weight of 487.92 g/mol. Its IUPAC name is (10R,11S,15R,16S)-N-(4-chlorophenyl)-13-(4-fluorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | (10R,11S,15R,16S)-N-(4-chlorophenyl)-13-(4-fluorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 6584849 |
| Molecular Formula | C27H19ClFN3O3 |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | (10R,11S,15R,16S)-N-(4-chlorophenyl)-13-(4-fluorophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@@H]1[C@@H]2C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]2[C@H]2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C27H19ClFN3O3/c28-16-6-10-18(11-7-16)30-25(33)24-23-22(21-14-5-15-3-1-2-4-20(15)32(21)24)26(34)31(27(23)35)19-12-8-17(29)9-13-19/h1-14,21-24H,(H,30,33)/t21-,22-,23-,24+/m1/s1 |
| InChIKey | GGMKBFLNEQPOKC-YCAMKHIRSA-N |
| XLogP | 4.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|