C28H22ClN3O4 — CID 3740707
N-(4-chlorophenyl)-13-(4-methoxyphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 3740707) has the molecular formula C28H22ClN3O4 and a molecular weight of 499.95 g/mol. Its IUPAC name is N-(4-chlorophenyl)-13-(4-methoxyphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | N-(4-chlorophenyl)-13-(4-methoxyphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 3740707 |
| Molecular Formula | C28H22ClN3O4 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | N-(4-chlorophenyl)-13-(4-methoxyphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | COc1ccc(N2C(=O)C3C(C2=O)C(C(=O)Nc2ccc(Cl)cc2)N2c4ccccc4C=CC32)cc1 |
| InChI | InChI=1S/C28H22ClN3O4/c1-36-20-13-11-19(12-14-20)31-27(34)23-22-15-6-16-4-2-3-5-21(16)32(22)25(24(23)28(31)35)26(33)30-18-9-7-17(29)8-10-18/h2-15,22-25H,1H3,(H,30,33) |
| InChIKey | IICKGZRBPGMZNT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|