C30H27N3O5 — CID 3795667
N-(2,5-dimethoxyphenyl)-13-(4-methylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 3795667) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-13-(4-methylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-13-(4-methylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 3795667 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-13-(4-methylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2C3C(=O)N(c4ccc(C)cc4)C(=O)C3C3C=Cc4ccccc4N32)c1 |
| InChI | InChI=1S/C30H27N3O5/c1-17-8-11-19(12-9-17)32-29(35)25-23-14-10-18-6-4-5-7-22(18)33(23)27(26(25)30(32)36)28(34)31-21-16-20(37-2)13-15-24(21)38-3/h4-16,23,25-27H,1-3H3,(H,31,34) |
| InChIKey | GHOAGIRRPXCCQS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|