C29H24N4O7 — CID 98477537
(10R,11S,15S,16S)-N-(2,5-dimethoxyphenyl)-13-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 98477537) has the molecular formula C29H24N4O7 and a molecular weight of 540.53 g/mol. Its IUPAC name is (10R,11S,15S,16S)-N-(2,5-dimethoxyphenyl)-13-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | (10R,11S,15S,16S)-N-(2,5-dimethoxyphenyl)-13-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 98477537 |
| Molecular Formula | C29H24N4O7 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | (10R,11S,15S,16S)-N-(2,5-dimethoxyphenyl)-13-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@@H]2[C@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@@H]3[C@H]3C=Cc4ccccc4N32)c1 |
| InChI | InChI=1S/C29H24N4O7/c1-39-19-12-14-23(40-2)20(15-19)30-27(34)26-25-24(22-13-7-16-5-3-4-6-21(16)32(22)26)28(35)31(29(25)36)17-8-10-18(11-9-17)33(37)38/h3-15,22,24-26H,1-2H3,(H,30,34)/t22-,24-,25+,26+/m1/s1 |
| InChIKey | RMFPQTYHSOMBIJ-BPHNFWMXSA-N |
| XLogP | 3.64 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|