C28H21N5O7 — CID 98512861
(10R,11R,15R,16S)-13-(2-methyl-4-nitrophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 98512861) has the molecular formula C28H21N5O7 and a molecular weight of 539.50 g/mol. Its IUPAC name is (10R,11R,15R,16S)-13-(2-methyl-4-nitrophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | (10R,11R,15R,16S)-13-(2-methyl-4-nitrophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 98512861 |
| Molecular Formula | C28H21N5O7 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | (10R,11R,15R,16S)-13-(2-methyl-4-nitrophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1C(=O)[C@@H]2[C@@H](C1=O)[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1)N1c3ccccc3C=C[C@H]21 |
| InChI | InChI=1S/C28H21N5O7/c1-15-14-19(33(39)40)11-13-20(15)31-27(35)23-22-12-6-16-4-2-3-5-21(16)30(22)25(24(23)28(31)36)26(34)29-17-7-9-18(10-8-17)32(37)38/h2-14,22-25H,1H3,(H,29,34)/t22-,23+,24-,25+/m1/s1 |
| InChIKey | YQCWNRLBUMQKIE-RCTAOEEJSA-N |
| XLogP | 3.84 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|