C27H19ClN4O5 — CID 3720062
13-(2-chlorophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 3720062) has the molecular formula C27H19ClN4O5 and a molecular weight of 514.93 g/mol. Its IUPAC name is 13-(2-chlorophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | 13-(2-chlorophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 3720062 |
| Molecular Formula | C27H19ClN4O5 |
| Molecular Weight | 514.93 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 13-(2-chlorophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C1C2C(=O)N(c3ccccc3Cl)C(=O)C2C2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C27H19ClN4O5/c28-18-6-2-4-8-20(18)31-26(34)22-21-14-9-15-5-1-3-7-19(15)30(21)24(23(22)27(31)35)25(33)29-16-10-12-17(13-11-16)32(36)37/h1-14,21-24H,(H,29,33) |
| InChIKey | OFSSHTWKXANFPL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|