C29H24ClN3O3 — CID 98511449
(10S,11S,15R,16S)-N-(4-chlorophenyl)-13-(2,4-dimethylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 98511449) has the molecular formula C29H24ClN3O3 and a molecular weight of 497.98 g/mol. Its IUPAC name is (10S,11S,15R,16S)-N-(4-chlorophenyl)-13-(2,4-dimethylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | (10S,11S,15R,16S)-N-(4-chlorophenyl)-13-(2,4-dimethylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 98511449 |
| Molecular Formula | C29H24ClN3O3 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | (10S,11S,15R,16S)-N-(4-chlorophenyl)-13-(2,4-dimethylphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=Cc4ccccc4N2[C@@H]3C(=O)Nc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C29H24ClN3O3/c1-16-7-13-21(17(2)15-16)33-28(35)24-23-14-8-18-5-3-4-6-22(18)32(23)26(25(24)29(33)36)27(34)31-20-11-9-19(30)10-12-20/h3-15,23-26H,1-2H3,(H,31,34)/t23-,24+,25+,26-/m0/s1 |
| InChIKey | JYDCKBUQHNKXSP-QUMGSSFMSA-N |
| XLogP | 4.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|