C27H18Cl2N4O5 — CID 100884934
(10S,11S,15R,16S)-13-(2,4-dichlorophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 100884934) has the molecular formula C27H18Cl2N4O5 and a molecular weight of 549.37 g/mol. Its IUPAC name is (10S,11S,15R,16S)-13-(2,4-dichlorophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | (10S,11S,15R,16S)-13-(2,4-dichlorophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 100884934 |
| Molecular Formula | C27H18Cl2N4O5 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | (10S,11S,15R,16S)-13-(2,4-dichlorophenyl)-N-(4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)[C@@H]1[C@@H]2C(=O)N(c3ccc(Cl)cc3Cl)C(=O)[C@@H]2[C@@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C27H18Cl2N4O5/c28-15-6-12-20(18(29)13-15)32-26(35)22-21-11-5-14-3-1-2-4-19(14)31(21)24(23(22)27(32)36)25(34)30-16-7-9-17(10-8-16)33(37)38/h1-13,21-24H,(H,30,34)/t21-,22+,23+,24-/m0/s1 |
| InChIKey | RGBVBOYPRRFCQI-KEZOAJOQSA-N |
| XLogP | 4.93 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|