C25H16Cl2N2O4 — CID 100878769
(10S,11S,15R,16S)-13-(2,4-dichlorophenyl)-16-(furan-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 100878769) has the molecular formula C25H16Cl2N2O4 and a molecular weight of 479.32 g/mol. Its IUPAC name is (10S,11S,15R,16S)-13-(2,4-dichlorophenyl)-16-(furan-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10S,11S,15R,16S)-13-(2,4-dichlorophenyl)-16-(furan-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 100878769 |
| Molecular Formula | C25H16Cl2N2O4 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | (10S,11S,15R,16S)-13-(2,4-dichlorophenyl)-16-(furan-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | O=C(c1ccco1)[C@@H]1[C@@H]2C(=O)N(c3ccc(Cl)cc3Cl)C(=O)[C@@H]2[C@@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C25H16Cl2N2O4/c26-14-8-10-17(15(27)12-14)29-24(31)20-18-9-7-13-4-1-2-5-16(13)28(18)22(21(20)25(29)32)23(30)19-6-3-11-33-19/h1-12,18,20-22H/t18-,20+,21+,22-/m0/s1 |
| InChIKey | OOLDTUYQBMHEKS-PDGJWGCVSA-N |
| XLogP | 4.86 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|