C30H23N3O7 — CID 98222175
[4-[(10S,11S,15R,16S)-13-(2-methyl-4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carbonyl]phenyl] acetate (PubChem CID 98222175) has the molecular formula C30H23N3O7 and a molecular weight of 537.53 g/mol. Its IUPAC name is [4-[(10S,11S,15R,16S)-13-(2-methyl-4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carbonyl]phenyl] acetate.
| Compound Name | [4-[(10S,11S,15R,16S)-13-(2-methyl-4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 98222175 |
| Molecular Formula | C30H23N3O7 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | [4-[(10S,11S,15R,16S)-13-(2-methyl-4-nitrophenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4C)C(=O)[C@@H]3[C@@H]3C=Cc4ccccc4N23)cc1 |
| InChI | InChI=1S/C30H23N3O7/c1-16-15-20(33(38)39)10-14-22(16)32-29(36)25-24-13-9-18-5-3-4-6-23(18)31(24)27(26(25)30(32)37)28(35)19-7-11-21(12-8-19)40-17(2)34/h3-15,24-27H,1-2H3/t24-,25+,26+,27-/m0/s1 |
| InChIKey | CFIFQVFEOMZXOE-YAOOYPAMSA-N |
| XLogP | 4.10 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|