C28H20BrN3O5 — CID 98165818
(10S,11R,15R,16S)-16-(4-bromobenzoyl)-13-(2-methyl-5-nitrophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 98165818) has the molecular formula C28H20BrN3O5 and a molecular weight of 558.39 g/mol. Its IUPAC name is (10S,11R,15R,16S)-16-(4-bromobenzoyl)-13-(2-methyl-5-nitrophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10S,11R,15R,16S)-16-(4-bromobenzoyl)-13-(2-methyl-5-nitrophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 98165818 |
| Molecular Formula | C28H20BrN3O5 |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | (10S,11R,15R,16S)-16-(4-bromobenzoyl)-13-(2-methyl-5-nitrophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@@H](C1=O)[C@@H]1C=Cc3ccccc3N1[C@@H]2C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H20BrN3O5/c1-15-6-12-19(32(36)37)14-22(15)31-27(34)23-21-13-9-16-4-2-3-5-20(16)30(21)25(24(23)28(31)35)26(33)17-7-10-18(29)11-8-17/h2-14,21,23-25H,1H3/t21-,23-,24+,25-/m0/s1 |
| InChIKey | DETZSMXXXYDDKV-CGBRIMPHSA-N |
| XLogP | 4.94 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|