C28H19BrClN3O6 — CID 100569026
(10R,11R,15S,16R)-16-(4-bromobenzoyl)-4-chloro-13-(2-methoxy-5-nitrophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 100569026) has the molecular formula C28H19BrClN3O6 and a molecular weight of 608.83 g/mol. Its IUPAC name is (10R,11R,15S,16R)-16-(4-bromobenzoyl)-4-chloro-13-(2-methoxy-5-nitrophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11R,15S,16R)-16-(4-bromobenzoyl)-4-chloro-13-(2-methoxy-5-nitrophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 100569026 |
| Molecular Formula | C28H19BrClN3O6 |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 607.01 |
| IUPAC Name | (10R,11R,15S,16R)-16-(4-bromobenzoyl)-4-chloro-13-(2-methoxy-5-nitrophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H](C(=O)c1ccc(Br)cc1)N1c3cc(Cl)ccc3C=C[C@H]21 |
| InChI | InChI=1S/C28H19BrClN3O6/c1-39-22-11-9-18(33(37)38)13-21(22)32-27(35)23-19-10-5-14-4-8-17(30)12-20(14)31(19)25(24(23)28(32)36)26(34)15-2-6-16(29)7-3-15/h2-13,19,23-25H,1H3/t19-,23+,24+,25-/m1/s1 |
| InChIKey | LZDUQVIBVQDPDJ-LJYZBVLISA-N |
| XLogP | 5.29 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|