C31H22ClN3O7 — CID 98493897
(3aR,4S,9aR,9bS)-8-benzoyl-4-(4-chlorobenzoyl)-2-(2-methoxy-5-nitrophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione (PubChem CID 98493897) has the molecular formula C31H22ClN3O7 and a molecular weight of 583.98 g/mol. Its IUPAC name is (3aR,4S,9aR,9bS)-8-benzoyl-4-(4-chlorobenzoyl)-2-(2-methoxy-5-nitrophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione.
| Compound Name | (3aR,4S,9aR,9bS)-8-benzoyl-4-(4-chlorobenzoyl)-2-(2-methoxy-5-nitrophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione |
|---|---|
| PubChem CID | 98493897 |
| Molecular Formula | C31H22ClN3O7 |
| Molecular Weight | 583.98 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | (3aR,4S,9aR,9bS)-8-benzoyl-4-(4-chlorobenzoyl)-2-(2-methoxy-5-nitrophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C(C(=O)c3ccccc3)C=CN1[C@@H]2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H22ClN3O7/c1-42-24-12-11-21(35(40)41)16-22(24)34-30(38)25-23-15-19(28(36)17-5-3-2-4-6-17)13-14-33(23)27(26(25)31(34)39)29(37)18-7-9-20(32)10-8-18/h2-16,23,25-27H,1H3/t23-,25-,26-,27+/m1/s1 |
| InChIKey | RZCRIPGWOLRUCK-WSEBHVOGSA-N |
| XLogP | 4.63 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.98 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|