C30H19Cl3N2O4 — CID 98455389
(3aS,4R,9aS,9bS)-8-benzoyl-4-(4-chlorobenzoyl)-2-(3,5-dichlorophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione (PubChem CID 98455389) has the molecular formula C30H19Cl3N2O4 and a molecular weight of 577.85 g/mol. Its IUPAC name is (3aS,4R,9aS,9bS)-8-benzoyl-4-(4-chlorobenzoyl)-2-(3,5-dichlorophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione.
| Compound Name | (3aS,4R,9aS,9bS)-8-benzoyl-4-(4-chlorobenzoyl)-2-(3,5-dichlorophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione |
|---|---|
| PubChem CID | 98455389 |
| Molecular Formula | C30H19Cl3N2O4 |
| Molecular Weight | 577.85 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | (3aS,4R,9aS,9bS)-8-benzoyl-4-(4-chlorobenzoyl)-2-(3,5-dichlorophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione |
| SMILES | O=C(C1=C[C@H]2[C@H]3C(=O)N(c4cc(Cl)cc(Cl)c4)C(=O)[C@@H]3[C@H](C(=O)c3ccc(Cl)cc3)N2C=C1)c1ccccc1 |
| InChI | InChI=1S/C30H19Cl3N2O4/c31-19-8-6-17(7-9-19)28(37)26-25-24(29(38)35(30(25)39)22-14-20(32)13-21(33)15-22)23-12-18(10-11-34(23)26)27(36)16-4-2-1-3-5-16/h1-15,23-26H/t23-,24+,25-,26+/m0/s1 |
| InChIKey | RLWDGICRUMATSI-ROXDYWFKSA-N |
| XLogP | 6.02 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.85 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|