C30H20BrFN2O4 — CID 100869319
(3aR,4S,9aR,9bR)-8-benzoyl-4-(4-bromobenzoyl)-2-(4-fluorophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione (PubChem CID 100869319) has the molecular formula C30H20BrFN2O4 and a molecular weight of 571.40 g/mol. Its IUPAC name is (3aR,4S,9aR,9bR)-8-benzoyl-4-(4-bromobenzoyl)-2-(4-fluorophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione.
| Compound Name | (3aR,4S,9aR,9bR)-8-benzoyl-4-(4-bromobenzoyl)-2-(4-fluorophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione |
|---|---|
| PubChem CID | 100869319 |
| Molecular Formula | C30H20BrFN2O4 |
| Molecular Weight | 571.40 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | (3aR,4S,9aR,9bR)-8-benzoyl-4-(4-bromobenzoyl)-2-(4-fluorophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione |
| SMILES | O=C(C1=C[C@@H]2[C@@H]3C(=O)N(c4ccc(F)cc4)C(=O)[C@H]3[C@@H](C(=O)c3ccc(Br)cc3)N2C=C1)c1ccccc1 |
| InChI | InChI=1S/C30H20BrFN2O4/c31-20-8-6-18(7-9-20)28(36)26-25-24(29(37)34(30(25)38)22-12-10-21(32)11-13-22)23-16-19(14-15-33(23)26)27(35)17-4-2-1-3-5-17/h1-16,23-26H/t23-,24+,25-,26+/m1/s1 |
| InChIKey | OFAQWAKBQTWRLJ-ZJSPYRCASA-N |
| XLogP | 4.97 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|