C30H20ClN3O6 — CID 4921571
8-benzoyl-4-(4-chlorobenzoyl)-2-(4-nitrophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione (PubChem CID 4921571) has the molecular formula C30H20ClN3O6 and a molecular weight of 553.96 g/mol. Its IUPAC name is 8-benzoyl-4-(4-chlorobenzoyl)-2-(4-nitrophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione.
| Compound Name | 8-benzoyl-4-(4-chlorobenzoyl)-2-(4-nitrophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione |
|---|---|
| PubChem CID | 4921571 |
| Molecular Formula | C30H20ClN3O6 |
| Molecular Weight | 553.96 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | 8-benzoyl-4-(4-chlorobenzoyl)-2-(4-nitrophenyl)-3a,4,9a,9b-tetrahydropyrrolo[3,4-a]indolizine-1,3-dione |
| SMILES | O=C(C1=CC2C3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C3C(C(=O)c3ccc(Cl)cc3)N2C=C1)c1ccccc1 |
| InChI | InChI=1S/C30H20ClN3O6/c31-20-8-6-18(7-9-20)28(36)26-25-24(29(37)33(30(25)38)21-10-12-22(13-11-21)34(39)40)23-16-19(14-15-32(23)26)27(35)17-4-2-1-3-5-17/h1-16,23-26H |
| InChIKey | PDKSISDXLDTXHJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.96 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|