C30H25N3O7 — CID 98537600
(10R,11S,15S,16R)-13-(1,3-benzodioxol-5-yl)-N-(2,5-dimethoxyphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide (PubChem CID 98537600) has the molecular formula C30H25N3O7 and a molecular weight of 539.54 g/mol. Its IUPAC name is (10R,11S,15S,16R)-13-(1,3-benzodioxol-5-yl)-N-(2,5-dimethoxyphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide.
| Compound Name | (10R,11S,15S,16R)-13-(1,3-benzodioxol-5-yl)-N-(2,5-dimethoxyphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 98537600 |
| Molecular Formula | C30H25N3O7 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (10R,11S,15S,16R)-13-(1,3-benzodioxol-5-yl)-N-(2,5-dimethoxyphenyl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@H]2[C@H]3C(=O)N(c4ccc5c(c4)OCO5)C(=O)[C@@H]3[C@H]3C=Cc4ccccc4N32)c1 |
| InChI | InChI=1S/C30H25N3O7/c1-37-18-9-12-22(38-2)19(14-18)31-28(34)27-26-25(21-10-7-16-5-3-4-6-20(16)33(21)27)29(35)32(30(26)36)17-8-11-23-24(13-17)40-15-39-23/h3-14,21,25-27H,15H2,1-2H3,(H,31,34)/t21-,25-,26+,27-/m1/s1 |
| InChIKey | OUVMHTRJLYGUCD-ORZNUPDKSA-N |
| XLogP | 3.46 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|