C35H24N2O7 — CID 124786262
(4-benzoylphenyl) (10R,11R,15R,16S)-13-(1,3-benzodioxol-5-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate (PubChem CID 124786262) has the molecular formula C35H24N2O7 and a molecular weight of 584.58 g/mol. Its IUPAC name is (4-benzoylphenyl) (10R,11R,15R,16S)-13-(1,3-benzodioxol-5-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate.
| Compound Name | (4-benzoylphenyl) (10R,11R,15R,16S)-13-(1,3-benzodioxol-5-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 124786262 |
| Molecular Formula | C35H24N2O7 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | (4-benzoylphenyl) (10R,11R,15R,16S)-13-(1,3-benzodioxol-5-yl)-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carboxylate |
| SMILES | O=C(c1ccccc1)c1ccc(OC(=O)[C@@H]2[C@@H]3C(=O)N(c4ccc5c(c4)OCO5)C(=O)[C@H]3[C@H]3C=Cc4ccccc4N32)cc1 |
| InChI | InChI=1S/C35H24N2O7/c38-32(21-7-2-1-3-8-21)22-10-14-24(15-11-22)44-35(41)31-30-29(26-16-12-20-6-4-5-9-25(20)37(26)31)33(39)36(34(30)40)23-13-17-27-28(18-23)43-19-42-27/h1-18,26,29-31H,19H2/t26-,29+,30-,31+/m1/s1 |
| InChIKey | QTOWHENKLSQGHZ-ZSEZPNIJSA-N |
| XLogP | 4.64 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|