C29H24N2O5 — CID 3272272
16-(4-methoxybenzoyl)-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 3272272) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is 16-(4-methoxybenzoyl)-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | 16-(4-methoxybenzoyl)-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 3272272 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 16-(4-methoxybenzoyl)-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | COc1ccc(C(=O)C2C3C(=O)N(c4ccc(OC)cc4)C(=O)C3C3C=Cc4ccccc4N32)cc1 |
| InChI | InChI=1S/C29H24N2O5/c1-35-20-12-7-18(8-13-20)27(32)26-25-24(23-16-9-17-5-3-4-6-22(17)31(23)26)28(33)30(29(25)34)19-10-14-21(36-2)15-11-19/h3-16,23-26H,1-2H3 |
| InChIKey | JJZAZFWQSASJON-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|