C34H25FN2O4 — CID 98148524
benzhydryl (1R,11S,12R,16S)-14-(4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate (PubChem CID 98148524) has the molecular formula C34H25FN2O4 and a molecular weight of 544.58 g/mol. Its IUPAC name is benzhydryl (1R,11S,12R,16S)-14-(4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate.
| Compound Name | benzhydryl (1R,11S,12R,16S)-14-(4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 98148524 |
| Molecular Formula | C34H25FN2O4 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | benzhydryl (1R,11S,12R,16S)-14-(4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)[C@@H]1[C@@H]2C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C34H25FN2O4/c35-24-15-17-25(18-16-24)37-32(38)27-28(33(37)39)30(36-20-19-21-9-7-8-14-26(21)29(27)36)34(40)41-31(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-20,27-31H/t27-,28+,29-,30-/m0/s1 |
| InChIKey | HWLZFNGKLIGLMZ-XJYHXZFBSA-N |
| XLogP | 5.67 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|