C21H14FN3O2 — CID 5225989
14-(4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile (PubChem CID 5225989) has the molecular formula C21H14FN3O2 and a molecular weight of 359.36 g/mol. Its IUPAC name is 14-(4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile.
| Compound Name | 14-(4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile |
|---|---|
| PubChem CID | 5225989 |
| Molecular Formula | C21H14FN3O2 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 14-(4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile |
| SMILES | N#CC1C2C(=O)N(c3ccc(F)cc3)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C21H14FN3O2/c22-13-5-7-14(8-6-13)25-20(26)17-16(11-23)24-10-9-12-3-1-2-4-15(12)19(24)18(17)21(25)27/h1-10,16-19H |
| InChIKey | KGMZQFPVYSDMGT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|