C21H13ClFN3O2 — CID 11914417
(1R,11S,12R,16S)-14-(3-chloro-4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile (PubChem CID 11914417) has the molecular formula C21H13ClFN3O2 and a molecular weight of 393.81 g/mol. Its IUPAC name is (1R,11S,12R,16S)-14-(3-chloro-4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile.
| Compound Name | (1R,11S,12R,16S)-14-(3-chloro-4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile |
|---|---|
| PubChem CID | 11914417 |
| Molecular Formula | C21H13ClFN3O2 |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (1R,11S,12R,16S)-14-(3-chloro-4-fluorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile |
| SMILES | N#C[C@@H]1[C@@H]2C(=O)N(c3ccc(F)c(Cl)c3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C21H13ClFN3O2/c22-14-9-12(5-6-15(14)23)26-20(27)17-16(10-24)25-8-7-11-3-1-2-4-13(11)19(25)18(17)21(26)28/h1-9,16-19H/t16-,17+,18+,19+/m1/s1 |
| InChIKey | RLWFGRFNTJCAKV-XWSJACJDSA-N |
| XLogP | 3.52 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|